C17H20F3N3O4S — CID 122468113
(3R,4S,6R)-2-(hydroxymethyl)-6-propylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122468113) has the molecular formula C17H20F3N3O4S and a molecular weight of 419.43 g/mol. Its IUPAC name is (3R,4S,6R)-2-(hydroxymethyl)-6-propylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (3R,4S,6R)-2-(hydroxymethyl)-6-propylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468113 |
| Molecular Formula | C17H20F3N3O4S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3R,4S,6R)-2-(hydroxymethyl)-6-propylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | CCCS[C@H]1OC(CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1O |
| InChI | InChI=1S/C17H20F3N3O4S/c1-2-3-28-17-16(26)14(15(25)12(7-24)27-17)23-6-11(21-22-23)8-4-9(18)13(20)10(19)5-8/h4-6,12,14-17,24-26H,2-3,7H2,1H3/t12?,14-,15-,16?,17+/m0/s1 |
| InChIKey | VCKPYMZYEOWSOG-JQSLPKACSA-N |
| XLogP | 1.49 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|