C19H17F3N4O4S — CID 122468114
(3R,4S,6R)-2-(hydroxymethyl)-6-pyridin-4-ylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122468114) has the molecular formula C19H17F3N4O4S and a molecular weight of 454.43 g/mol. Its IUPAC name is (3R,4S,6R)-2-(hydroxymethyl)-6-pyridin-4-ylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (3R,4S,6R)-2-(hydroxymethyl)-6-pyridin-4-ylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468114 |
| Molecular Formula | C19H17F3N4O4S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (3R,4S,6R)-2-(hydroxymethyl)-6-pyridin-4-ylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OCC1O[C@H](Sc2ccncc2)C(O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C19H17F3N4O4S/c20-11-5-9(6-12(21)15(11)22)13-7-26(25-24-13)16-17(28)14(8-27)30-19(18(16)29)31-10-1-3-23-4-2-10/h1-7,14,16-19,27-29H,8H2/t14?,16-,17-,18?,19+/m0/s1 |
| InChIKey | OYFKIWDHSXZVEG-FLYLVDQASA-N |
| XLogP | 1.53 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|