C13H22N4 — CID 122468312
(Z,2Z)-4-amino-N',3-dimethyl-2-(4-methylidenepiperidin-3-ylidene)pent-3-enimidamide (PubChem CID 122468312) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is (Z,2Z)-4-amino-N',3-dimethyl-2-(4-methylidenepiperidin-3-ylidene)pent-3-enimidamide.
| Compound Name | (Z,2Z)-4-amino-N',3-dimethyl-2-(4-methylidenepiperidin-3-ylidene)pent-3-enimidamide |
|---|---|
| PubChem CID | 122468312 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (Z,2Z)-4-amino-N',3-dimethyl-2-(4-methylidenepiperidin-3-ylidene)pent-3-enimidamide |
| SMILES | C=C1CCNC/C1=C(C(\N)=N\C)/C(C)=C(/C)N |
| InChI | InChI=1S/C13H22N4/c1-8-5-6-17-7-11(8)12(13(15)16-4)9(2)10(3)14/h17H,1,5-7,14H2,2-4H3,(H2,15,16)/b10-9-,12-11+ |
| InChIKey | MZSDYDVAJQJYNI-XAZJVICWSA-N |
| XLogP | 1.07 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|