About (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide
(Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide (PubChem CID 122468378) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide.
Molecular Properties
| Compound Name | (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide |
| PubChem CID | 122468378 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide |
| SMILES | C/N=C(\N)C(/C(C)=C(/C)N)C1CNCCC1C |
| InChI | InChI=1S/C13H26N4/c1-8-5-6-17-7-11(8)12(13(15)16-4)9(2)10(3)14/h8,11-12,17H,5-7,14H2,1-4H3,(H2,15,16)/b10-9- |
| InChIKey | USYNDBMPWHCLNQ-KTKRTIGZSA-N |
| XLogP | 1.09 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide?
The IUPAC name of (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide (CID 122468378) is (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide.
What is the SMILES notation for (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide?
The canonical SMILES for (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide is C/N=C(\N)C(/C(C)=C(/C)N)C1CNCCC1C.
What is the InChIKey of (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide?
The InChIKey is USYNDBMPWHCLNQ-KTKRTIGZSA-N. The full InChI is InChI=1S/C13H26N4/c1-8-5-6-17-7-11(8)12(13(15)16-4)9(2)10(3)14/h8,11-12,17H,5-7,14H2,1-4H3,(H2,15,16)/b10-9-.
What are the key properties of (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide?
(Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide has a molecular weight of 238.38 g/mol, XLogP of 1.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-N',3-dimethyl-2-(4-methylpiperidin-3-yl)pent-3-enimidamide is sourced from PubChem (CID 122468378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).