About 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde
6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde (PubChem CID 122468417) has the molecular formula C15H10N2OS
and a molecular weight of 266.32 g/mol. Its IUPAC name is 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde |
| PubChem CID | 122468417 |
| Molecular Formula | C15H10N2OS |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde |
| SMILES | C=Cc1ccnc2cc(-c3ccc(C=O)cn3)sc12 |
| InChI | InChI=1S/C15H10N2OS/c1-2-11-5-6-16-13-7-14(19-15(11)13)12-4-3-10(9-18)8-17-12/h2-9H,1H2 |
| InChIKey | RNUJOUPLFUGPSL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde?
The IUPAC name of 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde (CID 122468417) is 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde.
What is the SMILES notation for 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde?
The canonical SMILES for 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde is C=Cc1ccnc2cc(-c3ccc(C=O)cn3)sc12.
What is the InChIKey of 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde?
The InChIKey is RNUJOUPLFUGPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2OS/c1-2-11-5-6-16-13-7-14(19-15(11)13)12-4-3-10(9-18)8-17-12/h2-9H,1H2.
What are the key properties of 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde?
6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde has a molecular weight of 266.32 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(7-ethenylthieno[3,2-b]pyridin-2-yl)pyridine-3-carbaldehyde is sourced from PubChem (CID 122468417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).