About (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane
(2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane (PubChem CID 122468667) has the molecular formula C17H33FO4
and a molecular weight of 320.45 g/mol. Its IUPAC name is (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane.
Molecular Properties
| Compound Name | (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane |
| PubChem CID | 122468667 |
| Molecular Formula | C17H33FO4 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane |
| SMILES | CCCCOC[C@H]1O[C@@H](F)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C17H33FO4/c1-4-7-10-19-13-14-15(20-11-8-5-2)16(17(18)22-14)21-12-9-6-3/h14-17H,4-13H2,1-3H3/t14-,15?,16?,17-/m1/s1 |
| InChIKey | ZPTQUVTWMPHZNG-RDHHWEPZSA-N |
| XLogP | 3.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane?
The IUPAC name of (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane (CID 122468667) is (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane.
What is the SMILES notation for (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane?
The canonical SMILES for (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane is CCCCOC[C@H]1O[C@@H](F)C(OCCCC)C1OCCCC.
What is the InChIKey of (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane?
The InChIKey is ZPTQUVTWMPHZNG-RDHHWEPZSA-N. The full InChI is InChI=1S/C17H33FO4/c1-4-7-10-19-13-14-15(20-11-8-5-2)16(17(18)22-14)21-12-9-6-3/h14-17H,4-13H2,1-3H3/t14-,15?,16?,17-/m1/s1.
What are the key properties of (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane?
(2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane has a molecular weight of 320.45 g/mol, XLogP of 3.87, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-3,4-dibutoxy-2-(butoxymethyl)-5-fluorooxolane is sourced from PubChem (CID 122468667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).