C7H15N3 — CID 122468740
(1E,3E)-1-N,4-dimethylpenta-1,3-diene-1,2,5-triamine (PubChem CID 122468740) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is (1E,3E)-1-N,4-dimethylpenta-1,3-diene-1,2,5-triamine.
| Compound Name | (1E,3E)-1-N,4-dimethylpenta-1,3-diene-1,2,5-triamine |
|---|---|
| PubChem CID | 122468740 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (1E,3E)-1-N,4-dimethylpenta-1,3-diene-1,2,5-triamine |
| SMILES | CN/C=C(N)\C=C(/C)CN |
| InChI | InChI=1S/C7H15N3/c1-6(4-8)3-7(9)5-10-2/h3,5,10H,4,8-9H2,1-2H3/b6-3+,7-5+ |
| InChIKey | RYESDZGSIQMHBI-SNCPXTGUSA-N |
| XLogP | -0.09 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|