C8H16N2 — CID 122468761
(2Z,4Z)-2-ethylhexa-2,4-diene-1,3-diamine (PubChem CID 122468761) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (2Z,4Z)-2-ethylhexa-2,4-diene-1,3-diamine.
| Compound Name | (2Z,4Z)-2-ethylhexa-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 122468761 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (2Z,4Z)-2-ethylhexa-2,4-diene-1,3-diamine |
| SMILES | C/C=C\C(N)=C(/CC)CN |
| InChI | InChI=1S/C8H16N2/c1-3-5-8(10)7(4-2)6-9/h3,5H,4,6,9-10H2,1-2H3/b5-3-,8-7- |
| InChIKey | RHCHOAVIEMICGZ-OVRZELKPSA-N |
| XLogP | 1.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|