About 4-fluoro-3,6-dihydro-2H-pyridin-1-amine
4-fluoro-3,6-dihydro-2H-pyridin-1-amine (PubChem CID 122468818) has the molecular formula C5H9FN2
and a molecular weight of 116.14 g/mol. Its IUPAC name is 4-fluoro-3,6-dihydro-2H-pyridin-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-3,6-dihydro-2H-pyridin-1-amine |
| PubChem CID | 122468818 |
| Molecular Formula | C5H9FN2 |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 4-fluoro-3,6-dihydro-2H-pyridin-1-amine |
| SMILES | NN1CC=C(F)CC1 |
| InChI | InChI=1S/C5H9FN2/c6-5-1-3-8(7)4-2-5/h1H,2-4,7H2 |
| InChIKey | JHIGJLBEVROAQJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3,6-dihydro-2H-pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3,6-dihydro-2H-pyridin-1-amine?
The IUPAC name of 4-fluoro-3,6-dihydro-2H-pyridin-1-amine (CID 122468818) is 4-fluoro-3,6-dihydro-2H-pyridin-1-amine.
What is the SMILES notation for 4-fluoro-3,6-dihydro-2H-pyridin-1-amine?
The canonical SMILES for 4-fluoro-3,6-dihydro-2H-pyridin-1-amine is NN1CC=C(F)CC1.
What is the InChIKey of 4-fluoro-3,6-dihydro-2H-pyridin-1-amine?
The InChIKey is JHIGJLBEVROAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2/c6-5-1-3-8(7)4-2-5/h1H,2-4,7H2.
What are the key properties of 4-fluoro-3,6-dihydro-2H-pyridin-1-amine?
4-fluoro-3,6-dihydro-2H-pyridin-1-amine has a molecular weight of 116.14 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,6-dihydro-2H-pyridin-1-amine is sourced from PubChem (CID 122468818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).