C23H31N7O2 — CID 122468945
1-[4-(6,6-dimethyl-4-morpholin-4-yl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl)phenyl]-2-propan-2-ylhydrazine (PubChem CID 122468945) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-[4-(6,6-dimethyl-4-morpholin-4-yl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl)phenyl]-2-propan-2-ylhydrazine.
| Compound Name | 1-[4-(6,6-dimethyl-4-morpholin-4-yl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl)phenyl]-2-propan-2-ylhydrazine |
|---|---|
| PubChem CID | 122468945 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[4-(6,6-dimethyl-4-morpholin-4-yl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl)phenyl]-2-propan-2-ylhydrazine |
| SMILES | CC(C)NNc1ccc(-c2nc(N3CCOCC3)c3nc4n(c3n2)CCOC4(C)C)cc1 |
| InChI | InChI=1S/C23H31N7O2/c1-15(2)27-28-17-7-5-16(6-8-17)19-25-20(29-9-12-31-13-10-29)18-21(26-19)30-11-14-32-23(3,4)22(30)24-18/h5-8,15,27-28H,9-14H2,1-4H3 |
| InChIKey | XIOYYAZHQPGSMH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|