C27H18N2O — CID 122469318
15-phenyl-5-[(E)-2-phenylethenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene (PubChem CID 122469318) has the molecular formula C27H18N2O and a molecular weight of 386.45 g/mol. Its IUPAC name is 15-phenyl-5-[(E)-2-phenylethenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene.
| Compound Name | 15-phenyl-5-[(E)-2-phenylethenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene |
|---|---|
| PubChem CID | 122469318 |
| Molecular Formula | C27H18N2O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 15-phenyl-5-[(E)-2-phenylethenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene |
| SMILES | C(=C/c1ccc2c(c1)Oc1cccc3nc(-c4ccccc4)n-2c13)\c1ccccc1 |
| InChI | InChI=1S/C27H18N2O/c1-3-8-19(9-4-1)14-15-20-16-17-23-25(18-20)30-24-13-7-12-22-26(24)29(23)27(28-22)21-10-5-2-6-11-21/h1-18H/b15-14+ |
| InChIKey | LTABQXUCZVRFOF-CCEZHUSRSA-N |
| XLogP | 6.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|