C11H12F6N2O2 — CID 122470194
4-propan-2-yl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 122470194) has the molecular formula C11H12F6N2O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 4-propan-2-yl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | 4-propan-2-yl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 122470194 |
| Molecular Formula | C11H12F6N2O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-propan-2-yl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | CC(C)c1cc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F6N2O2/c1-6(2)7-3-8(20-4-10(12,13)14)19-9(18-7)21-5-11(15,16)17/h3,6H,4-5H2,1-2H3 |
| InChIKey | PGWFCZNDNUZGQN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |