C20H25N7OS — CID 122470520
1-[3-[[[2-[(1-butylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]methyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 122470520) has the molecular formula C20H25N7OS and a molecular weight of 411.54 g/mol. Its IUPAC name is 1-[3-[[[2-[(1-butylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]methyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[[2-[(1-butylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]methyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122470520 |
| Molecular Formula | C20H25N7OS |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[3-[[[2-[(1-butylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]methyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(CNc2nc(Nc3cnn(CCCC)c3)nc3ccsc23)C1 |
| InChI | InChI=1S/C20H25N7OS/c1-3-5-7-27-13-15(10-22-27)23-20-24-16-6-8-29-18(16)19(25-20)21-9-14-11-26(12-14)17(28)4-2/h4,6,8,10,13-14H,2-3,5,7,9,11-12H2,1H3,(H2,21,23,24,25) |
| InChIKey | VXVDHBPJGFXQLI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|