C17H19N7OS — CID 122470523
1-[(3R)-3-[[2-[(1-methylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 122470523) has the molecular formula C17H19N7OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-[(3R)-3-[[2-[(1-methylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[2-[(1-methylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122470523 |
| Molecular Formula | C17H19N7OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[(3R)-3-[[2-[(1-methylpyrazol-4-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2nc(Nc3cnn(C)c3)nc3ccsc23)C1 |
| InChI | InChI=1S/C17H19N7OS/c1-3-14(25)24-6-4-11(10-24)19-16-15-13(5-7-26-15)21-17(22-16)20-12-8-18-23(2)9-12/h3,5,7-9,11H,1,4,6,10H2,2H3,(H2,19,20,21,22)/t11-/m1/s1 |
| InChIKey | CUKVMOUCKMUAHN-LLVKDONJSA-N |
| XLogP | 2.37 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|