C20H25N7O2S — CID 122470536
1-[(3R)-3-[[2-[[1-(3-methoxypropyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 122470536) has the molecular formula C20H25N7O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-[(3R)-3-[[2-[[1-(3-methoxypropyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[2-[[1-(3-methoxypropyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122470536 |
| Molecular Formula | C20H25N7O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[(3R)-3-[[2-[[1-(3-methoxypropyl)pyrazol-4-yl]amino]thieno[3,2-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2nc(Nc3cnn(CCCOC)c3)nc3ccsc23)C1 |
| InChI | InChI=1S/C20H25N7O2S/c1-3-17(28)26-8-5-14(12-26)22-19-18-16(6-10-30-18)24-20(25-19)23-15-11-21-27(13-15)7-4-9-29-2/h3,6,10-11,13-14H,1,4-5,7-9,12H2,2H3,(H2,22,23,24,25)/t14-/m1/s1 |
| InChIKey | BGEKUBCHYOUASC-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|