About methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine
methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine (PubChem CID 122470756) has the molecular formula C15H26N2O4S
and a molecular weight of 330.45 g/mol. Its IUPAC name is methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine.
Molecular Properties
| Compound Name | methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine |
| PubChem CID | 122470756 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine |
| SMILES | C=C(CCC)C(N)=O.CNC.COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C6H11NO.C2H7N/c1-10-11(8,9)7-5-3-2-4-6-7;1-3-4-5(2)6(7)8;1-3-2/h2-6H,1H3;2-4H2,1H3,(H2,7,8);3H,1-2H3 |
| InChIKey | HKMOPAAXPZAUIC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine?
The IUPAC name of methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine (CID 122470756) is methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine.
What is the SMILES notation for methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine?
The canonical SMILES for methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine is C=C(CCC)C(N)=O.CNC.COS(=O)(=O)c1ccccc1.
What is the InChIKey of methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine?
The InChIKey is HKMOPAAXPZAUIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H11NO.C2H7N/c1-10-11(8,9)7-5-3-2-4-6-7;1-3-4-5(2)6(7)8;1-3-2/h2-6H,1H3;2-4H2,1H3,(H2,7,8);3H,1-2H3.
What are the key properties of methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine?
methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine has a molecular weight of 330.45 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl benzenesulfonate;2-methylidenepentanamide;N-methylmethanamine is sourced from PubChem (CID 122470756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).