About 3-butyl-1,7-dimethylisoquinoline
3-butyl-1,7-dimethylisoquinoline (PubChem CID 122471104) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-butyl-1,7-dimethylisoquinoline.
Molecular Properties
| Compound Name | 3-butyl-1,7-dimethylisoquinoline |
| PubChem CID | 122471104 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3-butyl-1,7-dimethylisoquinoline |
| SMILES | CCCCc1cc2ccc(C)cc2c(C)n1 |
| InChI | InChI=1S/C15H19N/c1-4-5-6-14-10-13-8-7-11(2)9-15(13)12(3)16-14/h7-10H,4-6H2,1-3H3 |
| InChIKey | NFGOFYVSAWENNC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butyl-1,7-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,7-dimethylisoquinoline?
The IUPAC name of 3-butyl-1,7-dimethylisoquinoline (CID 122471104) is 3-butyl-1,7-dimethylisoquinoline.
What is the SMILES notation for 3-butyl-1,7-dimethylisoquinoline?
The canonical SMILES for 3-butyl-1,7-dimethylisoquinoline is CCCCc1cc2ccc(C)cc2c(C)n1.
What is the InChIKey of 3-butyl-1,7-dimethylisoquinoline?
The InChIKey is NFGOFYVSAWENNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-4-5-6-14-10-13-8-7-11(2)9-15(13)12(3)16-14/h7-10H,4-6H2,1-3H3.
What are the key properties of 3-butyl-1,7-dimethylisoquinoline?
3-butyl-1,7-dimethylisoquinoline has a molecular weight of 213.32 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,7-dimethylisoquinoline is sourced from PubChem (CID 122471104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).