C37H23N5 — CID 122471965
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylbenzo[k][1,8]phenanthroline (PubChem CID 122471965) has the molecular formula C37H23N5 and a molecular weight of 537.63 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylbenzo[k][1,8]phenanthroline.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylbenzo[k][1,8]phenanthroline |
|---|---|
| PubChem CID | 122471965 |
| Molecular Formula | C37H23N5 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenylbenzo[k][1,8]phenanthroline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)nc(-c3ccccc3)c3ccc5cccnc5c34)n2)cc1 |
| InChI | InChI=1S/C37H23N5/c1-4-11-24(12-5-1)33-30-21-18-25-17-10-22-38-34(25)32(30)29-20-19-28(23-31(29)39-33)37-41-35(26-13-6-2-7-14-26)40-36(42-37)27-15-8-3-9-16-27/h1-23H |
| InChIKey | WAIQSNJFTOWCMS-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|