C25H26N6 — CID 122472052
3-N,1,4,6,8,11,13-heptamethylquinoxalino[2,3-b]phenazine-3,9-diamine (PubChem CID 122472052) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 3-N,1,4,6,8,11,13-heptamethylquinoxalino[2,3-b]phenazine-3,9-diamine.
| Compound Name | 3-N,1,4,6,8,11,13-heptamethylquinoxalino[2,3-b]phenazine-3,9-diamine |
|---|---|
| PubChem CID | 122472052 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-N,1,4,6,8,11,13-heptamethylquinoxalino[2,3-b]phenazine-3,9-diamine |
| SMILES | CNc1cc(C)c2nc3c(C)c4nc5c(C)cc(N)c(C)c5nc4c(C)c3nc2c1C |
| InChI | InChI=1S/C25H26N6/c1-10-8-16(26)12(3)20-18(10)28-22-14(5)23-25(15(6)24(22)30-20)31-21-13(4)17(27-7)9-11(2)19(21)29-23/h8-9,27H,26H2,1-7H3 |
| InChIKey | YNLCPFUZQOPUJX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|