C21H24N6O2 — CID 122472072
16-methyl-4,5,12,15,16,19-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione (PubChem CID 122472072) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 16-methyl-4,5,12,15,16,19-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione.
| Compound Name | 16-methyl-4,5,12,15,16,19-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
|---|---|
| PubChem CID | 122472072 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 16-methyl-4,5,12,15,16,19-hexazatetracyclo[19.3.1.12,5.014,18]hexacosa-1(25),2(26),3,14,17,21,23-heptaene-13,20-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCCCn1cc(cn1)-c1cccc(c1)C(=O)N2 |
| InChI | InChI=1S/C21H24N6O2/c1-26-14-18-19(25-26)21(29)22-9-4-2-3-5-10-27-13-17(12-23-27)15-7-6-8-16(11-15)20(28)24-18/h6-8,11-14H,2-5,9-10H2,1H3,(H,22,29)(H,24,28) |
| InChIKey | WYLVPVUYCUHITQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |