C20H25N7O4S2 — CID 122472785
[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl] carbamate (PubChem CID 122472785) has the molecular formula C20H25N7O4S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is [(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl] carbamate.
| Compound Name | [(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl] carbamate |
|---|---|
| PubChem CID | 122472785 |
| Molecular Formula | C20H25N7O4S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl] carbamate |
| SMILES | CS(=O)c1nnc(-c2cc3c(N[C@@H]4CC[C@](C)(OC(N)=O)C4(C)C)c(C(N)=O)cnn3c2)s1 |
| InChI | InChI=1S/C20H25N7O4S2/c1-19(2)13(5-6-20(19,3)31-17(22)29)24-14-11(15(21)28)8-23-27-9-10(7-12(14)27)16-25-26-18(32-16)33(4)30/h7-9,13,24H,5-6H2,1-4H3,(H2,21,28)(H2,22,29)/t13-,20+,33?/m1/s1 |
| InChIKey | BHCSZUKPXDKIPL-MECAVYQYSA-N |
| XLogP | 2.14 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |