C26H20ClFN6OS — CID 122473003
2-chloro-N-[3-(3-fluorophenyl)-8-methyl-2,4-dihydro-[1,3]thiazino[3,2-a]benzimidazol-3-yl]-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 122473003) has the molecular formula C26H20ClFN6OS and a molecular weight of 519.01 g/mol. Its IUPAC name is 2-chloro-N-[3-(3-fluorophenyl)-8-methyl-2,4-dihydro-[1,3]thiazino[3,2-a]benzimidazol-3-yl]-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-chloro-N-[3-(3-fluorophenyl)-8-methyl-2,4-dihydro-[1,3]thiazino[3,2-a]benzimidazol-3-yl]-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 122473003 |
| Molecular Formula | C26H20ClFN6OS |
| Molecular Weight | 519.01 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 2-chloro-N-[3-(3-fluorophenyl)-8-methyl-2,4-dihydro-[1,3]thiazino[3,2-a]benzimidazol-3-yl]-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)nc1n2CC(NC(=O)c2ccc(-n3cnnc3)cc2Cl)(c2cccc(F)c2)CS1 |
| InChI | InChI=1S/C26H20ClFN6OS/c1-16-5-8-23-22(9-16)31-25-34(23)12-26(13-36-25,17-3-2-4-18(28)10-17)32-24(35)20-7-6-19(11-21(20)27)33-14-29-30-15-33/h2-11,14-15H,12-13H2,1H3,(H,32,35) |
| InChIKey | NWSYDYWYKGMDMO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.01 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |