About 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole
2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole (PubChem CID 122473006) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole.
Molecular Properties
| Compound Name | 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole |
| PubChem CID | 122473006 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole |
| SMILES | Cc1ccc2c(c1)cc1n2CC(c2ccccc2)([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H18N2O2/c1-14-7-8-18-15(11-14)12-17-9-10-19(21(22)23,13-20(17)18)16-5-3-2-4-6-16/h2-8,11-12H,9-10,13H2,1H3 |
| InChIKey | XEHDTLPYNDDAPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole?
The IUPAC name of 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole (CID 122473006) is 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole.
What is the SMILES notation for 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole?
The canonical SMILES for 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole is Cc1ccc2c(c1)cc1n2CC(c2ccccc2)([N+](=O)[O-])CC1.
What is the InChIKey of 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole?
The InChIKey is XEHDTLPYNDDAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-14-7-8-18-15(11-14)12-17-9-10-19(21(22)23,13-20(17)18)16-5-3-2-4-6-16/h2-8,11-12H,9-10,13H2,1H3.
What are the key properties of 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole?
2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole has a molecular weight of 306.37 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-nitro-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indole is sourced from PubChem (CID 122473006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).