About methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate
methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate (PubChem CID 122473023) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate |
| PubChem CID | 122473023 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate |
| SMILES | COCOc1cc(C)cn2nc3c(c12)C(=O)C(C(=O)OC)CC3 |
| InChI | InChI=1S/C16H18N2O5/c1-9-6-12(23-8-21-2)14-13-11(17-18(14)7-9)5-4-10(15(13)19)16(20)22-3/h6-7,10H,4-5,8H2,1-3H3 |
| InChIKey | ZOBQCAKRUZCNKP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate?
The IUPAC name of methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate (CID 122473023) is methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate.
What is the SMILES notation for methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate?
The canonical SMILES for methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate is COCOc1cc(C)cn2nc3c(c12)C(=O)C(C(=O)OC)CC3.
What is the InChIKey of methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate?
The InChIKey is ZOBQCAKRUZCNKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-9-6-12(23-8-21-2)14-13-11(17-18(14)7-9)5-4-10(15(13)19)16(20)22-3/h6-7,10H,4-5,8H2,1-3H3.
What are the key properties of methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate?
methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate has a molecular weight of 318.33 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10-(methoxymethoxy)-8-methyl-1-oxo-3,4-dihydro-2H-pyrido[1,2-b]indazole-2-carboxylate is sourced from PubChem (CID 122473023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).