C30H25ClF3N5O2 — CID 122473223
2-chloro-N-[(7S)-2-methyl-7-phenyl-10-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 122473223) has the molecular formula C30H25ClF3N5O2 and a molecular weight of 580.01 g/mol. Its IUPAC name is 2-chloro-N-[(7S)-2-methyl-7-phenyl-10-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-chloro-N-[(7S)-2-methyl-7-phenyl-10-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 122473223 |
| Molecular Formula | C30H25ClF3N5O2 |
| Molecular Weight | 580.01 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 2-chloro-N-[(7S)-2-methyl-7-phenyl-10-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)c([C@@H](O)C(F)(F)F)c1n2C[C@@](NC(=O)c2ccc(-n3cnnc3)cc2Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H25ClF3N5O2/c1-18-7-10-24-22(13-18)26(27(40)30(32,33)34)25-11-12-29(15-39(24)25,19-5-3-2-4-6-19)37-28(41)21-9-8-20(14-23(21)31)38-16-35-36-17-38/h2-10,13-14,16-17,27,40H,11-12,15H2,1H3,(H,37,41)/t27-,29-/m1/s1 |
| InChIKey | VBRWQXAXGZTCEZ-XRKRLSELSA-N |
| XLogP | 6.05 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|