C26H25Cl2N9O — CID 122473239
2,6-dichloro-N-[2-(1-ethyltriazol-4-yl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide (PubChem CID 122473239) has the molecular formula C26H25Cl2N9O and a molecular weight of 550.45 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(1-ethyltriazol-4-yl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[2-(1-ethyltriazol-4-yl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122473239 |
| Molecular Formula | C26H25Cl2N9O |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 2,6-dichloro-N-[2-(1-ethyltriazol-4-yl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
| SMILES | CCn1cc(C2(NC(=O)c3c(Cl)cc(-n4cnc(C)n4)cc3Cl)CCc3nn4cc(C)ccc4c3C2)nn1 |
| InChI | InChI=1S/C26H25Cl2N9O/c1-4-35-13-23(31-34-35)26(8-7-21-18(11-26)22-6-5-15(2)12-36(22)33-21)30-25(38)24-19(27)9-17(10-20(24)28)37-14-29-16(3)32-37/h5-6,9-10,12-14H,4,7-8,11H2,1-3H3,(H,30,38) |
| InChIKey | LSSXYNWAFSXLBT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |