C14H16N4O — CID 122473458
1-(10-ethyl-3,7-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)ethanone (PubChem CID 122473458) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(10-ethyl-3,7-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)ethanone.
| Compound Name | 1-(10-ethyl-3,7-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)ethanone |
|---|---|
| PubChem CID | 122473458 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(10-ethyl-3,7-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)ethanone |
| SMILES | CCn1c(C(C)=O)cc2c3c(ncn3C)c(C)nc21 |
| InChI | InChI=1S/C14H16N4O/c1-5-18-11(9(3)19)6-10-13-12(15-7-17(13)4)8(2)16-14(10)18/h6-7H,5H2,1-4H3 |
| InChIKey | SEPJWDMIVIKCRF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |