C16H21N5O — CID 122473470
1-(7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)-2-methylbutan-1-one (PubChem CID 122473470) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 1-(7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)-2-methylbutan-1-one.
| Compound Name | 1-(7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 122473470 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-(7-amino-10-ethyl-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1cc2c3c(ncn3C)c(N)nc2n1CC |
| InChI | InChI=1S/C16H21N5O/c1-5-9(3)14(22)11-7-10-13-12(18-8-20(13)4)15(17)19-16(10)21(11)6-2/h7-9H,5-6H2,1-4H3,(H2,17,19) |
| InChIKey | NSAYUXAPXZWHRZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |