C9H8F6N2O2 — CID 122473474
4-methyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 122473474) has the molecular formula C9H8F6N2O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is 4-methyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | 4-methyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 122473474 |
| Molecular Formula | C9H8F6N2O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-methyl-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | Cc1cc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F6N2O2/c1-5-2-6(18-3-8(10,11)12)17-7(16-5)19-4-9(13,14)15/h2H,3-4H2,1H3 |
| InChIKey | TWGVVUDLTYUDSV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |