About 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid
2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid (PubChem CID 122473822) has the molecular formula C13H16N4O4
and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
| PubChem CID | 122473822 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)c2c([N+](=O)[O-])cc(N)cc2n1C |
| InChI | InChI=1S/C13H16N4O4/c1-6-8(5-9(15)13(18)19)12-10(16(6)2)3-7(14)4-11(12)17(20)21/h3-4,9H,5,14-15H2,1-2H3,(H,18,19) |
| InChIKey | NMOVCJJWEUHALF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid?
The IUPAC name of 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid (CID 122473822) is 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid is Cc1c(CC(N)C(=O)O)c2c([N+](=O)[O-])cc(N)cc2n1C.
What is the InChIKey of 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid?
The InChIKey is NMOVCJJWEUHALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O4/c1-6-8(5-9(15)13(18)19)12-10(16(6)2)3-7(14)4-11(12)17(20)21/h3-4,9H,5,14-15H2,1-2H3,(H,18,19).
What are the key properties of 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid?
2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid has a molecular weight of 292.30 g/mol, XLogP of 0.93, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(6-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid is sourced from PubChem (CID 122473822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).