C27H28FN7O3 — CID 122474175
N-[3-[5-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-[1,2]oxazolo[4,3-d]pyrimidin-3-yl]phenyl]prop-2-enamide (PubChem CID 122474175) has the molecular formula C27H28FN7O3 and a molecular weight of 517.57 g/mol. Its IUPAC name is N-[3-[5-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-[1,2]oxazolo[4,3-d]pyrimidin-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-[1,2]oxazolo[4,3-d]pyrimidin-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474175 |
| Molecular Formula | C27H28FN7O3 |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[3-[5-[3-fluoro-4-[4-(2-methoxyethyl)piperazin-1-yl]anilino]-[1,2]oxazolo[4,3-d]pyrimidin-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2onc3cnc(Nc4ccc(N5CCN(CCOC)CC5)c(F)c4)nc23)c1 |
| InChI | InChI=1S/C27H28FN7O3/c1-3-24(36)30-19-6-4-5-18(15-19)26-25-22(33-38-26)17-29-27(32-25)31-20-7-8-23(21(28)16-20)35-11-9-34(10-12-35)13-14-37-2/h3-8,15-17H,1,9-14H2,2H3,(H,30,36)(H,31,32) |
| InChIKey | ILNYSFBWASWPEX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|