C26H27F2N5O5S — CID 122474372
2-(2,6-difluoro-3,5-dimethoxyphenyl)-6-[1-[(1,1-dioxothiazinan-3-yl)methyl]pyrazol-4-yl]spiro[1H-2,7-naphthyridine-4,1'-cyclopropane]-3-one (PubChem CID 122474372) has the molecular formula C26H27F2N5O5S and a molecular weight of 559.60 g/mol. Its IUPAC name is 2-(2,6-difluoro-3,5-dimethoxyphenyl)-6-[1-[(1,1-dioxothiazinan-3-yl)methyl]pyrazol-4-yl]spiro[1H-2,7-naphthyridine-4,1'-cyclopropane]-3-one.
| Compound Name | 2-(2,6-difluoro-3,5-dimethoxyphenyl)-6-[1-[(1,1-dioxothiazinan-3-yl)methyl]pyrazol-4-yl]spiro[1H-2,7-naphthyridine-4,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 122474372 |
| Molecular Formula | C26H27F2N5O5S |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 2-(2,6-difluoro-3,5-dimethoxyphenyl)-6-[1-[(1,1-dioxothiazinan-3-yl)methyl]pyrazol-4-yl]spiro[1H-2,7-naphthyridine-4,1'-cyclopropane]-3-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc(-c4cnn(CC5CCCS(=O)(=O)N5)c4)cc3C3(CC3)C2=O)c1F |
| InChI | InChI=1S/C26H27F2N5O5S/c1-37-20-9-21(38-2)23(28)24(22(20)27)33-13-15-10-29-19(8-18(15)26(5-6-26)25(33)34)16-11-30-32(12-16)14-17-4-3-7-39(35,36)31-17/h8-12,17,31H,3-7,13-14H2,1-2H3 |
| InChIKey | VDHKWZQYVVXNBC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |