About 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde
1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde (PubChem CID 122476064) has the molecular formula C15H11F2NO
and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde |
| PubChem CID | 122476064 |
| Molecular Formula | C15H11F2NO |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde |
| SMILES | O=Cc1cccc2c1CCN2c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2NO/c16-13-5-4-11(8-14(13)17)18-7-6-12-10(9-19)2-1-3-15(12)18/h1-5,8-9H,6-7H2 |
| InChIKey | JKBUYKLBPCDFFH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde?
The IUPAC name of 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde (CID 122476064) is 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde.
What is the SMILES notation for 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde?
The canonical SMILES for 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde is O=Cc1cccc2c1CCN2c1ccc(F)c(F)c1.
What is the InChIKey of 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde?
The InChIKey is JKBUYKLBPCDFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NO/c16-13-5-4-11(8-14(13)17)18-7-6-12-10(9-19)2-1-3-15(12)18/h1-5,8-9H,6-7H2.
What are the key properties of 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde?
1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde has a molecular weight of 259.26 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-2,3-dihydroindole-4-carbaldehyde is sourced from PubChem (CID 122476064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).