About 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde
3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde (PubChem CID 122476619) has the molecular formula C16H10F6OS
and a molecular weight of 364.31 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde |
| PubChem CID | 122476619 |
| Molecular Formula | C16H10F6OS |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde |
| SMILES | O=Cc1cccc(CSc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H10F6OS/c17-15(18,19)12-5-13(16(20,21)22)7-14(6-12)24-9-11-3-1-2-10(4-11)8-23/h1-8H,9H2 |
| InChIKey | SWKSJRMKFZYBSJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde?
The IUPAC name of 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde (CID 122476619) is 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde.
What is the SMILES notation for 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde?
The canonical SMILES for 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde is O=Cc1cccc(CSc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.
What is the InChIKey of 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde?
The InChIKey is SWKSJRMKFZYBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F6OS/c17-15(18,19)12-5-13(16(20,21)22)7-14(6-12)24-9-11-3-1-2-10(4-11)8-23/h1-8H,9H2.
What are the key properties of 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde?
3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde has a molecular weight of 364.31 g/mol, XLogP of 5.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde is sourced from PubChem (CID 122476619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).