C16H10F6OS — CID 122476619
3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde (PubChem CID 122476619) has the molecular formula C16H10F6OS and a molecular weight of 364.31 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde |
|---|---|
| PubChem CID | 122476619 |
| Molecular Formula | C16H10F6OS |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]sulfanylmethyl]benzaldehyde |
| SMILES | O=Cc1cccc(CSc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H10F6OS/c17-15(18,19)12-5-13(16(20,21)22)7-14(6-12)24-9-11-3-1-2-10(4-11)8-23/h1-8H,9H2 |
| InChIKey | SWKSJRMKFZYBSJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|