C22H23F2N3O4 — CID 122477084
N-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5,5-dimethyl-6-oxo-8H-2,7-naphthyridin-3-yl]methyl]prop-2-enamide (PubChem CID 122477084) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is N-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5,5-dimethyl-6-oxo-8H-2,7-naphthyridin-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5,5-dimethyl-6-oxo-8H-2,7-naphthyridin-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 122477084 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-5,5-dimethyl-6-oxo-8H-2,7-naphthyridin-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc2c(cn1)CN(c1c(F)c(OC)cc(OC)c1F)C(=O)C2(C)C |
| InChI | InChI=1S/C22H23F2N3O4/c1-6-17(28)26-10-13-7-14-12(9-25-13)11-27(21(29)22(14,2)3)20-18(23)15(30-4)8-16(31-5)19(20)24/h6-9H,1,10-11H2,2-5H3,(H,26,28) |
| InChIKey | NRKXDEYPXNONFT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|