About 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde
5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 122477399) has the molecular formula C14H13F2NO2
and a molecular weight of 265.26 g/mol. Its IUPAC name is 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 122477399 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | CC(C)(C)c1oc(-c2ccc(F)c(F)c2)nc1C=O |
| InChI | InChI=1S/C14H13F2NO2/c1-14(2,3)12-11(7-18)17-13(19-12)8-4-5-9(15)10(16)6-8/h4-7H,1-3H3 |
| InChIKey | QUIUBBWPGAOWOT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde (CID 122477399) is 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde is CC(C)(C)c1oc(-c2ccc(F)c(F)c2)nc1C=O.
What is the InChIKey of 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde?
The InChIKey is QUIUBBWPGAOWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2/c1-14(2,3)12-11(7-18)17-13(19-12)8-4-5-9(15)10(16)6-8/h4-7H,1-3H3.
What are the key properties of 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde?
5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde has a molecular weight of 265.26 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-(3,4-difluorophenyl)-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 122477399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).