About 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile
5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122478061) has the molecular formula C17H9F3N4O3
and a molecular weight of 374.28 g/mol. Its IUPAC name is 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122478061 |
| Molecular Formula | C17H9F3N4O3 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cc(OC(F)(F)F)cc(-c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H9F3N4O3/c18-17(19,20)27-12-4-10(9-1-2-14-15(6-9)26-8-25-14)3-11(5-12)16-13(7-21)22-24-23-16/h1-6H,8H2,(H,22,23,24) |
| InChIKey | XMIGXHIPBGSVJS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile (CID 122478061) is 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cc(OC(F)(F)F)cc(-c2ccc3c(c2)OCO3)c1.
What is the InChIKey of 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile?
The InChIKey is XMIGXHIPBGSVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F3N4O3/c18-17(19,20)27-12-4-10(9-1-2-14-15(6-9)26-8-25-14)3-11(5-12)16-13(7-21)22-24-23-16/h1-6H,8H2,(H,22,23,24).
What are the key properties of 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile?
5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile has a molecular weight of 374.28 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,3-benzodioxol-5-yl)-5-(trifluoromethoxy)phenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122478061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).