About 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile
5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122478106) has the molecular formula C16H8F2N4O2
and a molecular weight of 326.26 g/mol. Its IUPAC name is 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122478106 |
| Molecular Formula | C16H8F2N4O2 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc(-c2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C16H8F2N4O2/c17-16(18)23-13-6-5-11(7-14(13)24-16)9-1-3-10(4-2-9)15-12(8-19)20-22-21-15/h1-7H,(H,20,21,22) |
| InChIKey | ZZWLFJRPINVHSX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile (CID 122478106) is 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1ccc(-c2ccc3c(c2)OC(F)(F)O3)cc1.
What is the InChIKey of 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile?
The InChIKey is ZZWLFJRPINVHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F2N4O2/c17-16(18)23-13-6-5-11(7-14(13)24-16)9-1-3-10(4-2-9)15-12(8-19)20-22-21-15/h1-7H,(H,20,21,22).
What are the key properties of 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile?
5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile has a molecular weight of 326.26 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122478106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).