C14H6ClF3N6 — CID 122478112
5-[3-chloro-4-[4-(trifluoromethyl)pyrimidin-2-yl]phenyl]-2H-triazole-4-carbonitrile (PubChem CID 122478112) has the molecular formula C14H6ClF3N6 and a molecular weight of 350.69 g/mol. Its IUPAC name is 5-[3-chloro-4-[4-(trifluoromethyl)pyrimidin-2-yl]phenyl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[3-chloro-4-[4-(trifluoromethyl)pyrimidin-2-yl]phenyl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122478112 |
| Molecular Formula | C14H6ClF3N6 |
| Molecular Weight | 350.69 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-[3-chloro-4-[4-(trifluoromethyl)pyrimidin-2-yl]phenyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc(-c2nccc(C(F)(F)F)n2)c(Cl)c1 |
| InChI | InChI=1S/C14H6ClF3N6/c15-9-5-7(12-10(6-19)22-24-23-12)1-2-8(9)13-20-4-3-11(21-13)14(16,17)18/h1-5H,(H,22,23,24) |
| InChIKey | OTKGDEYDFPDCFJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |