About 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile
5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile (PubChem CID 122478921) has the molecular formula C16H10F3N5O
and a molecular weight of 345.28 g/mol. Its IUPAC name is 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122478921 |
| Molecular Formula | C16H10F3N5O |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1cccc(COCc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C16H10F3N5O/c17-11-5-13(19)12(18)4-9(11)7-25-8-10-2-1-3-14(21-10)16-15(6-20)22-24-23-16/h1-5H,7-8H2,(H,22,23,24) |
| InChIKey | WCJQMFDEBIRJRI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile (CID 122478921) is 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1cccc(COCc2cc(F)c(F)cc2F)n1.
What is the InChIKey of 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile?
The InChIKey is WCJQMFDEBIRJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N5O/c17-11-5-13(19)12(18)4-9(11)7-25-8-10-2-1-3-14(21-10)16-15(6-20)22-24-23-16/h1-5H,7-8H2,(H,22,23,24).
What are the key properties of 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile?
5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile has a molecular weight of 345.28 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[(2,4,5-trifluorophenyl)methoxymethyl]-2-pyridinyl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122478921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).