About 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile
5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile (PubChem CID 122479013) has the molecular formula C17H11F2N5
and a molecular weight of 323.31 g/mol. Its IUPAC name is 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile |
| PubChem CID | 122479013 |
| Molecular Formula | C17H11F2N5 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1-c1ccc2c(c1)N(c1cc(F)ccc1F)CC2 |
| InChI | InChI=1S/C17H11F2N5/c18-12-3-4-13(19)16(8-12)24-6-5-10-1-2-11(7-15(10)24)17-14(9-20)21-23-22-17/h1-4,7-8H,5-6H2,(H,21,22,23) |
| InChIKey | PWODXONQRUNCOX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile?
The IUPAC name of 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile (CID 122479013) is 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile is N#Cc1n[nH]nc1-c1ccc2c(c1)N(c1cc(F)ccc1F)CC2.
What is the InChIKey of 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile?
The InChIKey is PWODXONQRUNCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2N5/c18-12-3-4-13(19)16(8-12)24-6-5-10-1-2-11(7-15(10)24)17-14(9-20)21-23-22-17/h1-4,7-8H,5-6H2,(H,21,22,23).
What are the key properties of 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile?
5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile has a molecular weight of 323.31 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,5-difluorophenyl)-2,3-dihydroindol-6-yl]-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122479013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).