C14H14ClN5 — CID 122479025
5-[1-(4-chlorophenyl)piperidin-3-yl]-2H-triazole-4-carbonitrile (PubChem CID 122479025) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)piperidin-3-yl]-2H-triazole-4-carbonitrile.
| Compound Name | 5-[1-(4-chlorophenyl)piperidin-3-yl]-2H-triazole-4-carbonitrile |
|---|---|
| PubChem CID | 122479025 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-[1-(4-chlorophenyl)piperidin-3-yl]-2H-triazole-4-carbonitrile |
| SMILES | N#Cc1n[nH]nc1C1CCCN(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H14ClN5/c15-11-3-5-12(6-4-11)20-7-1-2-10(9-20)14-13(8-16)17-19-18-14/h3-6,10H,1-2,7,9H2,(H,17,18,19) |
| InChIKey | MQBDDOVAOANKSV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |