About 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile
5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile (PubChem CID 122479253) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile |
| PubChem CID | 122479253 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile |
| SMILES | CN1CCOc2cc(-c3n[nH]nc3C#N)ccc21 |
| InChI | InChI=1S/C12H11N5O/c1-17-4-5-18-11-6-8(2-3-10(11)17)12-9(7-13)14-16-15-12/h2-3,6H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | NAAJMALPGYGRKY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile?
The IUPAC name of 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile (CID 122479253) is 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile.
What is the SMILES notation for 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile?
The canonical SMILES for 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile is CN1CCOc2cc(-c3n[nH]nc3C#N)ccc21.
What is the InChIKey of 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile?
The InChIKey is NAAJMALPGYGRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c1-17-4-5-18-11-6-8(2-3-10(11)17)12-9(7-13)14-16-15-12/h2-3,6H,4-5H2,1H3,(H,14,15,16).
What are the key properties of 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile?
5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile has a molecular weight of 241.25 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)-2H-triazole-4-carbonitrile is sourced from PubChem (CID 122479253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).