About N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide
N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide (PubChem CID 122480262) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide.
Molecular Properties
| Compound Name | N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide |
| PubChem CID | 122480262 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide |
| SMILES | CC(C)N(C)C(=O)C1(C)COC(=O)OC1 |
| InChI | InChI=1S/C10H17NO4/c1-7(2)11(4)8(12)10(3)5-14-9(13)15-6-10/h7H,5-6H2,1-4H3 |
| InChIKey | KNFWXCPKQCOALP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide?
The IUPAC name of N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide (CID 122480262) is N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide.
What is the SMILES notation for N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide?
The canonical SMILES for N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide is CC(C)N(C)C(=O)C1(C)COC(=O)OC1.
What is the InChIKey of N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide?
The InChIKey is KNFWXCPKQCOALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-7(2)11(4)8(12)10(3)5-14-9(13)15-6-10/h7H,5-6H2,1-4H3.
What are the key properties of N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide?
N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide has a molecular weight of 215.25 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-2-oxo-N-propan-2-yl-1,3-dioxane-5-carboxamide is sourced from PubChem (CID 122480262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).