About 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide
6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide (PubChem CID 122480734) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide |
| PubChem CID | 122480734 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cn2c(n1)CCC2 |
| InChI | InChI=1S/C6H9N3O2S/c7-12(10,11)6-4-9-3-1-2-5(9)8-6/h4H,1-3H2,(H2,7,10,11) |
| InChIKey | YQKSSYQFTUUWHD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide (CID 122480734) is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide is NS(=O)(=O)c1cn2c(n1)CCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide?
The InChIKey is YQKSSYQFTUUWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c7-12(10,11)6-4-9-3-1-2-5(9)8-6/h4H,1-3H2,(H2,7,10,11).
What are the key properties of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide?
6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide has a molecular weight of 187.22 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonamide is sourced from PubChem (CID 122480734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).