About 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride
6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride (PubChem CID 122480749) has the molecular formula C6H7ClN2O2S
and a molecular weight of 206.65 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride |
| PubChem CID | 122480749 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cn2c(n1)CCC2 |
| InChI | InChI=1S/C6H7ClN2O2S/c7-12(10,11)6-4-9-3-1-2-5(9)8-6/h4H,1-3H2 |
| InChIKey | JCXKJCBHFOIVPE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride (CID 122480749) is 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride is O=S(=O)(Cl)c1cn2c(n1)CCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride?
The InChIKey is JCXKJCBHFOIVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S/c7-12(10,11)6-4-9-3-1-2-5(9)8-6/h4H,1-3H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride?
6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride has a molecular weight of 206.65 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-sulfonyl chloride is sourced from PubChem (CID 122480749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).