C14H25F8NO3S — CID 122480815
1,1,2,2,3,3,4,4-octafluorohexane-1-sulfonate;tetraethylazanium (PubChem CID 122480815) has the molecular formula C14H25F8NO3S and a molecular weight of 439.41 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluorohexane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4-octafluorohexane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 122480815 |
| Molecular Formula | C14H25F8NO3S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluorohexane-1-sulfonate;tetraethylazanium |
| SMILES | CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C6H6F8O3S/c1-5-9(6-2,7-3)8-4;1-2-3(7,8)4(9,10)5(11,12)6(13,14)18(15,16)17/h5-8H2,1-4H3;2H2,1H3,(H,15,16,17)/q+1;/p-1 |
| InChIKey | YGELNSGASOSOSJ-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|