C14H22F11NO3S — CID 122481320
tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorohexane-1-sulfonate (PubChem CID 122481320) has the molecular formula C14H22F11NO3S and a molecular weight of 493.38 g/mol. Its IUPAC name is tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorohexane-1-sulfonate.
| Compound Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 122481320 |
| Molecular Formula | C14H22F11NO3S |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorohexane-1-sulfonate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C8H20N.C6H3F11O3S/c1-5-9(6-2,7-3)8-4;7-1-2(8,9)3(10,11)4(12,13)5(14,15)6(16,17)21(18,19)20/h5-8H2,1-4H3;1H2,(H,18,19,20)/q+1;/p-1 |
| InChIKey | BXVNQPBNFXENSM-UHFFFAOYSA-M |
| XLogP | 4.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|