C14H29F4NO3S — CID 122481523
tetraethylazanium;1,1,2,2-tetrafluorohexane-1-sulfonate (PubChem CID 122481523) has the molecular formula C14H29F4NO3S and a molecular weight of 367.45 g/mol. Its IUPAC name is tetraethylazanium;1,1,2,2-tetrafluorohexane-1-sulfonate.
| Compound Name | tetraethylazanium;1,1,2,2-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 122481523 |
| Molecular Formula | C14H29F4NO3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tetraethylazanium;1,1,2,2-tetrafluorohexane-1-sulfonate |
| SMILES | CCCCC(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C6H10F4O3S/c1-5-9(6-2,7-3)8-4;1-2-3-4-5(7,8)6(9,10)14(11,12)13/h5-8H2,1-4H3;2-4H2,1H3,(H,11,12,13)/q+1;/p-1 |
| InChIKey | CNPTUCLNNKADPS-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|