C14H21F12NO3S — CID 122481753
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonate;tetraethylazanium (PubChem CID 122481753) has the molecular formula C14H21F12NO3S and a molecular weight of 511.37 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 122481753 |
| Molecular Formula | C14H21F12NO3S |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H20N.C6H2F12O3S/c1-5-9(6-2,7-3)8-4;7-1(8)2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)22(19,20)21/h5-8H2,1-4H3;1H,(H,19,20,21)/q+1;/p-1 |
| InChIKey | NUNVKGJDXNVYJC-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|